C22H24F2N2O4S — CID 75942994
3-[2-(difluoromethoxy)phenyl]-N-[(3-piperidin-1-ylsulfonylphenyl)methyl]prop-2-enamide (PubChem CID 75942994) has the molecular formula C22H24F2N2O4S and a molecular weight of 450.51 g/mol. Its IUPAC name is 3-[2-(difluoromethoxy)phenyl]-N-[(3-piperidin-1-ylsulfonylphenyl)methyl]prop-2-enamide.
| Compound Name | 3-[2-(difluoromethoxy)phenyl]-N-[(3-piperidin-1-ylsulfonylphenyl)methyl]prop-2-enamide |
|---|---|
| PubChem CID | 75942994 |
| Molecular Formula | C22H24F2N2O4S |
| Molecular Weight | 450.51 g/mol |
| Exact Mass | 450.14 |
| IUPAC Name | 3-[2-(difluoromethoxy)phenyl]-N-[(3-piperidin-1-ylsulfonylphenyl)methyl]prop-2-enamide |
| SMILES | O=C(C=Cc1ccccc1OC(F)F)NCc1cccc(S(=O)(=O)N2CCCCC2)c1 |
| InChI | InChI=1S/C22H24F2N2O4S/c23-22(24)30-20-10-3-2-8-18(20)11-12-21(27)25-16-17-7-6-9-19(15-17)31(28,29)26-13-4-1-5-14-26/h2-3,6-12,15,22H,1,4-5,13-14,16H2,(H,25,27) |
| InChIKey | CWFGQKZPSKHMLS-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.51 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|