C15H22ClN5O3 — CID 72692248
N,N-bis(2-amino-2-oxoethyl)-3-[5-chloro-3-methyl-1-(2-methylpropyl)pyrazol-4-yl]prop-2-enamide (PubChem CID 72692248) has the molecular formula C15H22ClN5O3 and a molecular weight of 355.83 g/mol. Its IUPAC name is N,N-bis(2-amino-2-oxoethyl)-3-[5-chloro-3-methyl-1-(2-methylpropyl)pyrazol-4-yl]prop-2-enamide.
| Compound Name | N,N-bis(2-amino-2-oxoethyl)-3-[5-chloro-3-methyl-1-(2-methylpropyl)pyrazol-4-yl]prop-2-enamide |
|---|---|
| PubChem CID | 72692248 |
| Molecular Formula | C15H22ClN5O3 |
| Molecular Weight | 355.83 g/mol |
| Exact Mass | 355.14 |
| IUPAC Name | N,N-bis(2-amino-2-oxoethyl)-3-[5-chloro-3-methyl-1-(2-methylpropyl)pyrazol-4-yl]prop-2-enamide |
| SMILES | Cc1nn(CC(C)C)c(Cl)c1C=CC(=O)N(CC(N)=O)CC(N)=O |
| InChI | InChI=1S/C15H22ClN5O3/c1-9(2)6-21-15(16)11(10(3)19-21)4-5-14(24)20(7-12(17)22)8-13(18)23/h4-5,9H,6-8H2,1-3H3,(H2,17,22)(H2,18,23) |
| InChIKey | SACDVKQNFKAWPJ-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 124.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.83 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|