C13H18ClN3O2 — CID 76941770
3-(5-chloro-1,3-dimethylpyrazol-4-yl)-1-[3-(hydroxymethyl)pyrrolidin-1-yl]prop-2-en-1-one (PubChem CID 76941770) has the molecular formula C13H18ClN3O2 and a molecular weight of 283.76 g/mol. Its IUPAC name is 3-(5-chloro-1,3-dimethylpyrazol-4-yl)-1-[3-(hydroxymethyl)pyrrolidin-1-yl]prop-2-en-1-one.
| Compound Name | 3-(5-chloro-1,3-dimethylpyrazol-4-yl)-1-[3-(hydroxymethyl)pyrrolidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 76941770 |
| Molecular Formula | C13H18ClN3O2 |
| Molecular Weight | 283.76 g/mol |
| Exact Mass | 283.11 |
| IUPAC Name | 3-(5-chloro-1,3-dimethylpyrazol-4-yl)-1-[3-(hydroxymethyl)pyrrolidin-1-yl]prop-2-en-1-one |
| SMILES | Cc1nn(C)c(Cl)c1C=CC(=O)N1CCC(CO)C1 |
| InChI | InChI=1S/C13H18ClN3O2/c1-9-11(13(14)16(2)15-9)3-4-12(19)17-6-5-10(7-17)8-18/h3-4,10,18H,5-8H2,1-2H3 |
| InChIKey | OOZQYVIAFZXNSC-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.76 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|