About 1-[(Z)-3-(5-chloro-1,3-dimethylpyrazol-4-yl)prop-2-enoyl]-N-methylpiperidine-4-carboxamide
1-[(Z)-3-(5-chloro-1,3-dimethylpyrazol-4-yl)prop-2-enoyl]-N-methylpiperidine-4-carboxamide (PubChem CID 97449821) has the molecular formula C15H21ClN4O2
and a molecular weight of 324.81 g/mol. Its IUPAC name is 1-[(Z)-3-(5-chloro-1,3-dimethylpyrazol-4-yl)prop-2-enoyl]-N-methylpiperidine-4-carboxamide.
Molecular Properties
| Compound Name | 1-[(Z)-3-(5-chloro-1,3-dimethylpyrazol-4-yl)prop-2-enoyl]-N-methylpiperidine-4-carboxamide |
| PubChem CID | 97449821 |
| Molecular Formula | C15H21ClN4O2 |
| Molecular Weight | 324.81 g/mol |
| Exact Mass | 324.14 |
| IUPAC Name | 1-[(Z)-3-(5-chloro-1,3-dimethylpyrazol-4-yl)prop-2-enoyl]-N-methylpiperidine-4-carboxamide |
| SMILES | CNC(=O)C1CCN(C(=O)/C=C\c2c(C)nn(C)c2Cl)CC1 |
| InChI | InChI=1S/C15H21ClN4O2/c1-10-12(14(16)19(3)18-10)4-5-13(21)20-8-6-11(7-9-20)15(22)17-2/h4-5,11H,6-9H2,1-3H3,(H,17,22)/b5-4- |
| InChIKey | CNKYRHVDXUJAHP-PLNGDYQASA-N |
| XLogP | 1.38 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.81 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 1-[(Z)-3-(5-chloro-1,3-dimethylpyrazol-4-yl)prop-2-enoyl]-N-methylpiperidine-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(Z)-3-(5-chloro-1,3-dimethylpyrazol-4-yl)prop-2-enoyl]-N-methylpiperidine-4-carboxamide?
The IUPAC name of 1-[(Z)-3-(5-chloro-1,3-dimethylpyrazol-4-yl)prop-2-enoyl]-N-methylpiperidine-4-carboxamide (CID 97449821) is 1-[(Z)-3-(5-chloro-1,3-dimethylpyrazol-4-yl)prop-2-enoyl]-N-methylpiperidine-4-carboxamide.
What is the SMILES notation for 1-[(Z)-3-(5-chloro-1,3-dimethylpyrazol-4-yl)prop-2-enoyl]-N-methylpiperidine-4-carboxamide?
The canonical SMILES for 1-[(Z)-3-(5-chloro-1,3-dimethylpyrazol-4-yl)prop-2-enoyl]-N-methylpiperidine-4-carboxamide is CNC(=O)C1CCN(C(=O)/C=C\c2c(C)nn(C)c2Cl)CC1.
What is the InChIKey of 1-[(Z)-3-(5-chloro-1,3-dimethylpyrazol-4-yl)prop-2-enoyl]-N-methylpiperidine-4-carboxamide?
The InChIKey is CNKYRHVDXUJAHP-PLNGDYQASA-N. The full InChI is InChI=1S/C15H21ClN4O2/c1-10-12(14(16)19(3)18-10)4-5-13(21)20-8-6-11(7-9-20)15(22)17-2/h4-5,11H,6-9H2,1-3H3,(H,17,22)/b5-4-.
What are the key properties of 1-[(Z)-3-(5-chloro-1,3-dimethylpyrazol-4-yl)prop-2-enoyl]-N-methylpiperidine-4-carboxamide?
1-[(Z)-3-(5-chloro-1,3-dimethylpyrazol-4-yl)prop-2-enoyl]-N-methylpiperidine-4-carboxamide has a molecular weight of 324.81 g/mol, XLogP of 1.38, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(Z)-3-(5-chloro-1,3-dimethylpyrazol-4-yl)prop-2-enoyl]-N-methylpiperidine-4-carboxamide is sourced from PubChem (CID 97449821), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).