C24H24N4O — CID 55440966
(E)-3-(2,5-dimethyl-1-phenylpyrrol-3-yl)-N-[(1-methylbenzimidazol-2-yl)methyl]prop-2-enamide (PubChem CID 55440966) has the molecular formula C24H24N4O and a molecular weight of 384.48 g/mol. Its IUPAC name is (E)-3-(2,5-dimethyl-1-phenylpyrrol-3-yl)-N-[(1-methylbenzimidazol-2-yl)methyl]prop-2-enamide.
| Compound Name | (E)-3-(2,5-dimethyl-1-phenylpyrrol-3-yl)-N-[(1-methylbenzimidazol-2-yl)methyl]prop-2-enamide |
|---|---|
| PubChem CID | 55440966 |
| Molecular Formula | C24H24N4O |
| Molecular Weight | 384.48 g/mol |
| Exact Mass | 384.20 |
| IUPAC Name | (E)-3-(2,5-dimethyl-1-phenylpyrrol-3-yl)-N-[(1-methylbenzimidazol-2-yl)methyl]prop-2-enamide |
| SMILES | Cc1cc(/C=C/C(=O)NCc2nc3ccccc3n2C)c(C)n1-c1ccccc1 |
| InChI | InChI=1S/C24H24N4O/c1-17-15-19(18(2)28(17)20-9-5-4-6-10-20)13-14-24(29)25-16-23-26-21-11-7-8-12-22(21)27(23)3/h4-15H,16H2,1-3H3,(H,25,29)/b14-13+ |
| InChIKey | VZBPPXLVBHZTJI-BUHFOSPRSA-N |
| XLogP | 4.31 |
| TPSA | 51.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.48 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|