C24H24F3N3O — CID 133170939
2-(2,4-dimethylphenyl)-N-[(E)-[2,5-dimethyl-1-[3-(trifluoromethyl)phenyl]pyrrol-3-yl]methylideneamino]acetamide (PubChem CID 133170939) has the molecular formula C24H24F3N3O and a molecular weight of 427.47 g/mol. Its IUPAC name is 2-(2,4-dimethylphenyl)-N-[(E)-[2,5-dimethyl-1-[3-(trifluoromethyl)phenyl]pyrrol-3-yl]methylideneamino]acetamide.
| Compound Name | 2-(2,4-dimethylphenyl)-N-[(E)-[2,5-dimethyl-1-[3-(trifluoromethyl)phenyl]pyrrol-3-yl]methylideneamino]acetamide |
|---|---|
| PubChem CID | 133170939 |
| Molecular Formula | C24H24F3N3O |
| Molecular Weight | 427.47 g/mol |
| Exact Mass | 427.19 |
| IUPAC Name | 2-(2,4-dimethylphenyl)-N-[(E)-[2,5-dimethyl-1-[3-(trifluoromethyl)phenyl]pyrrol-3-yl]methylideneamino]acetamide |
| SMILES | Cc1ccc(CC(=O)N/N=C/c2cc(C)n(-c3cccc(C(F)(F)F)c3)c2C)c(C)c1 |
| InChI | InChI=1S/C24H24F3N3O/c1-15-8-9-19(16(2)10-15)12-23(31)29-28-14-20-11-17(3)30(18(20)4)22-7-5-6-21(13-22)24(25,26)27/h5-11,13-14H,12H2,1-4H3,(H,29,31)/b28-14+ |
| InChIKey | CIQWWPFMYZYNKV-CCVNUDIWSA-N |
| XLogP | 5.42 |
| TPSA | 46.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.47 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|