C27H31N3O3 — CID 92657803
propan-2-yl 4-[3-[(Z)-[[2-(2,4-dimethylphenyl)acetyl]hydrazinylidene]methyl]-2,5-dimethylpyrrol-1-yl]benzoate (PubChem CID 92657803) has the molecular formula C27H31N3O3 and a molecular weight of 445.56 g/mol. Its IUPAC name is propan-2-yl 4-[3-[(Z)-[[2-(2,4-dimethylphenyl)acetyl]hydrazinylidene]methyl]-2,5-dimethylpyrrol-1-yl]benzoate.
| Compound Name | propan-2-yl 4-[3-[(Z)-[[2-(2,4-dimethylphenyl)acetyl]hydrazinylidene]methyl]-2,5-dimethylpyrrol-1-yl]benzoate |
|---|---|
| PubChem CID | 92657803 |
| Molecular Formula | C27H31N3O3 |
| Molecular Weight | 445.56 g/mol |
| Exact Mass | 445.24 |
| IUPAC Name | propan-2-yl 4-[3-[(Z)-[[2-(2,4-dimethylphenyl)acetyl]hydrazinylidene]methyl]-2,5-dimethylpyrrol-1-yl]benzoate |
| SMILES | Cc1ccc(CC(=O)N/N=C\c2cc(C)n(-c3ccc(C(=O)OC(C)C)cc3)c2C)c(C)c1 |
| InChI | InChI=1S/C27H31N3O3/c1-17(2)33-27(32)22-9-11-25(12-10-22)30-20(5)14-24(21(30)6)16-28-29-26(31)15-23-8-7-18(3)13-19(23)4/h7-14,16-17H,15H2,1-6H3,(H,29,31)/b28-16- |
| InChIKey | QIGRQOPBOBTPEL-NTFVMDSBSA-N |
| XLogP | 4.97 |
| TPSA | 72.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.56 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|