C24H26F3N3 — CID 1277305
1-[[2,5-dimethyl-1-[3-(trifluoromethyl)phenyl]pyrrol-3-yl]methyl]-4-phenylpiperazine (PubChem CID 1277305) has the molecular formula C24H26F3N3 and a molecular weight of 413.49 g/mol. Its IUPAC name is 1-[[2,5-dimethyl-1-[3-(trifluoromethyl)phenyl]pyrrol-3-yl]methyl]-4-phenylpiperazine.
| Compound Name | 1-[[2,5-dimethyl-1-[3-(trifluoromethyl)phenyl]pyrrol-3-yl]methyl]-4-phenylpiperazine |
|---|---|
| PubChem CID | 1277305 |
| Molecular Formula | C24H26F3N3 |
| Molecular Weight | 413.49 g/mol |
| Exact Mass | 413.21 |
| IUPAC Name | 1-[[2,5-dimethyl-1-[3-(trifluoromethyl)phenyl]pyrrol-3-yl]methyl]-4-phenylpiperazine |
| SMILES | Cc1cc(CN2CCN(c3ccccc3)CC2)c(C)n1-c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C24H26F3N3/c1-18-15-20(17-28-11-13-29(14-12-28)22-8-4-3-5-9-22)19(2)30(18)23-10-6-7-21(16-23)24(25,26)27/h3-10,15-16H,11-14,17H2,1-2H3 |
| InChIKey | XVRZJRLCQKYZRZ-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 11.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.49 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|