C28H27F3N4 — CID 10322750
1-[(2-methyl-5-phenyl-1-pyridin-2-ylpyrrol-3-yl)methyl]-4-[3-(trifluoromethyl)phenyl]piperazine (PubChem CID 10322750) has the molecular formula C28H27F3N4 and a molecular weight of 476.55 g/mol. Its IUPAC name is 1-[(2-methyl-5-phenyl-1-pyridin-2-ylpyrrol-3-yl)methyl]-4-[3-(trifluoromethyl)phenyl]piperazine.
| Compound Name | 1-[(2-methyl-5-phenyl-1-pyridin-2-ylpyrrol-3-yl)methyl]-4-[3-(trifluoromethyl)phenyl]piperazine |
|---|---|
| PubChem CID | 10322750 |
| Molecular Formula | C28H27F3N4 |
| Molecular Weight | 476.55 g/mol |
| Exact Mass | 476.22 |
| IUPAC Name | 1-[(2-methyl-5-phenyl-1-pyridin-2-ylpyrrol-3-yl)methyl]-4-[3-(trifluoromethyl)phenyl]piperazine |
| SMILES | Cc1c(CN2CCN(c3cccc(C(F)(F)F)c3)CC2)cc(-c2ccccc2)n1-c1ccccn1 |
| InChI | InChI=1S/C28H27F3N4/c1-21-23(18-26(22-8-3-2-4-9-22)35(21)27-12-5-6-13-32-27)20-33-14-16-34(17-15-33)25-11-7-10-24(19-25)28(29,30)31/h2-13,18-19H,14-17,20H2,1H3 |
| InChIKey | WKHUFJAHUOBXFV-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 24.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.55 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_B(29)', 'substructure': 'N/A'} |
|---|