C18H17ClF4N2 — CID 22199130
1-[(2-chloro-4-fluorophenyl)methyl]-4-[3-(trifluoromethyl)phenyl]piperazine (PubChem CID 22199130) has the molecular formula C18H17ClF4N2 and a molecular weight of 372.79 g/mol. Its IUPAC name is 1-[(2-chloro-4-fluorophenyl)methyl]-4-[3-(trifluoromethyl)phenyl]piperazine.
| Compound Name | 1-[(2-chloro-4-fluorophenyl)methyl]-4-[3-(trifluoromethyl)phenyl]piperazine |
|---|---|
| PubChem CID | 22199130 |
| Molecular Formula | C18H17ClF4N2 |
| Molecular Weight | 372.79 g/mol |
| Exact Mass | 372.10 |
| IUPAC Name | 1-[(2-chloro-4-fluorophenyl)methyl]-4-[3-(trifluoromethyl)phenyl]piperazine |
| SMILES | Fc1ccc(CN2CCN(c3cccc(C(F)(F)F)c3)CC2)c(Cl)c1 |
| InChI | InChI=1S/C18H17ClF4N2/c19-17-11-15(20)5-4-13(17)12-24-6-8-25(9-7-24)16-3-1-2-14(10-16)18(21,22)23/h1-5,10-11H,6-9,12H2 |
| InChIKey | ZVHPCRUGYIWNOH-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.79 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |