C22H20ClF3N2O — CID 1375701
1-[[5-(2-chlorophenyl)furan-2-yl]methyl]-4-[3-(trifluoromethyl)phenyl]piperazine (PubChem CID 1375701) has the molecular formula C22H20ClF3N2O and a molecular weight of 420.86 g/mol. Its IUPAC name is 1-[[5-(2-chlorophenyl)furan-2-yl]methyl]-4-[3-(trifluoromethyl)phenyl]piperazine.
| Compound Name | 1-[[5-(2-chlorophenyl)furan-2-yl]methyl]-4-[3-(trifluoromethyl)phenyl]piperazine |
|---|---|
| PubChem CID | 1375701 |
| Molecular Formula | C22H20ClF3N2O |
| Molecular Weight | 420.86 g/mol |
| Exact Mass | 420.12 |
| IUPAC Name | 1-[[5-(2-chlorophenyl)furan-2-yl]methyl]-4-[3-(trifluoromethyl)phenyl]piperazine |
| SMILES | FC(F)(F)c1cccc(N2CCN(Cc3ccc(-c4ccccc4Cl)o3)CC2)c1 |
| InChI | InChI=1S/C22H20ClF3N2O/c23-20-7-2-1-6-19(20)21-9-8-18(29-21)15-27-10-12-28(13-11-27)17-5-3-4-16(14-17)22(24,25)26/h1-9,14H,10-13,15H2 |
| InChIKey | SMLIBCBYTCCMDE-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 19.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.86 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |