C25H23F3N2O4 — CID 46818899
[2-[2,5-dimethyl-1-[3-(trifluoromethyl)phenyl]pyrrol-3-yl]-2-oxoethyl] 4-(acetamidomethyl)benzoate (PubChem CID 46818899) has the molecular formula C25H23F3N2O4 and a molecular weight of 472.46 g/mol. Its IUPAC name is [2-[2,5-dimethyl-1-[3-(trifluoromethyl)phenyl]pyrrol-3-yl]-2-oxoethyl] 4-(acetamidomethyl)benzoate.
| Compound Name | [2-[2,5-dimethyl-1-[3-(trifluoromethyl)phenyl]pyrrol-3-yl]-2-oxoethyl] 4-(acetamidomethyl)benzoate |
|---|---|
| PubChem CID | 46818899 |
| Molecular Formula | C25H23F3N2O4 |
| Molecular Weight | 472.46 g/mol |
| Exact Mass | 472.16 |
| IUPAC Name | [2-[2,5-dimethyl-1-[3-(trifluoromethyl)phenyl]pyrrol-3-yl]-2-oxoethyl] 4-(acetamidomethyl)benzoate |
| SMILES | CC(=O)NCc1ccc(C(=O)OCC(=O)c2cc(C)n(-c3cccc(C(F)(F)F)c3)c2C)cc1 |
| InChI | InChI=1S/C25H23F3N2O4/c1-15-11-22(16(2)30(15)21-6-4-5-20(12-21)25(26,27)28)23(32)14-34-24(33)19-9-7-18(8-10-19)13-29-17(3)31/h4-12H,13-14H2,1-3H3,(H,29,31) |
| InChIKey | QUGOEPYEJKUMHM-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 77.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.46 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|