C25H25FN2O4 — CID 46819109
[2-[1-(3-fluoro-4-methylphenyl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] 4-(acetamidomethyl)benzoate (PubChem CID 46819109) has the molecular formula C25H25FN2O4 and a molecular weight of 436.48 g/mol. Its IUPAC name is [2-[1-(3-fluoro-4-methylphenyl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] 4-(acetamidomethyl)benzoate.
| Compound Name | [2-[1-(3-fluoro-4-methylphenyl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] 4-(acetamidomethyl)benzoate |
|---|---|
| PubChem CID | 46819109 |
| Molecular Formula | C25H25FN2O4 |
| Molecular Weight | 436.48 g/mol |
| Exact Mass | 436.18 |
| IUPAC Name | [2-[1-(3-fluoro-4-methylphenyl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] 4-(acetamidomethyl)benzoate |
| SMILES | CC(=O)NCc1ccc(C(=O)OCC(=O)c2cc(C)n(-c3ccc(C)c(F)c3)c2C)cc1 |
| InChI | InChI=1S/C25H25FN2O4/c1-15-5-10-21(12-23(15)26)28-16(2)11-22(17(28)3)24(30)14-32-25(31)20-8-6-19(7-9-20)13-27-18(4)29/h5-12H,13-14H2,1-4H3,(H,27,29) |
| InChIKey | HVXXTQCOIXBSGS-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 77.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.48 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|