C24H23FN2O4S — CID 27066947
[2-[1-(3-fluoro-4-methylphenyl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] 2-(2-amino-2-oxoethyl)sulfanylbenzoate (PubChem CID 27066947) has the molecular formula C24H23FN2O4S and a molecular weight of 454.52 g/mol. Its IUPAC name is [2-[1-(3-fluoro-4-methylphenyl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] 2-(2-amino-2-oxoethyl)sulfanylbenzoate.
| Compound Name | [2-[1-(3-fluoro-4-methylphenyl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] 2-(2-amino-2-oxoethyl)sulfanylbenzoate |
|---|---|
| PubChem CID | 27066947 |
| Molecular Formula | C24H23FN2O4S |
| Molecular Weight | 454.52 g/mol |
| Exact Mass | 454.14 |
| IUPAC Name | [2-[1-(3-fluoro-4-methylphenyl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] 2-(2-amino-2-oxoethyl)sulfanylbenzoate |
| SMILES | Cc1ccc(-n2c(C)cc(C(=O)COC(=O)c3ccccc3SCC(N)=O)c2C)cc1F |
| InChI | InChI=1S/C24H23FN2O4S/c1-14-8-9-17(11-20(14)25)27-15(2)10-19(16(27)3)21(28)12-31-24(30)18-6-4-5-7-22(18)32-13-23(26)29/h4-11H,12-13H2,1-3H3,(H2,26,29) |
| InChIKey | NTEOMTFQTJBJJZ-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 91.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.52 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|