C20H15F3N2O6 — CID 3901142
[2-[2,5-dimethyl-1-[3-(trifluoromethyl)phenyl]pyrrol-3-yl]-2-oxoethyl] 5-nitrofuran-2-carboxylate (PubChem CID 3901142) has the molecular formula C20H15F3N2O6 and a molecular weight of 436.34 g/mol. Its IUPAC name is [2-[2,5-dimethyl-1-[3-(trifluoromethyl)phenyl]pyrrol-3-yl]-2-oxoethyl] 5-nitrofuran-2-carboxylate.
| Compound Name | [2-[2,5-dimethyl-1-[3-(trifluoromethyl)phenyl]pyrrol-3-yl]-2-oxoethyl] 5-nitrofuran-2-carboxylate |
|---|---|
| PubChem CID | 3901142 |
| Molecular Formula | C20H15F3N2O6 |
| Molecular Weight | 436.34 g/mol |
| Exact Mass | 436.09 |
| IUPAC Name | [2-[2,5-dimethyl-1-[3-(trifluoromethyl)phenyl]pyrrol-3-yl]-2-oxoethyl] 5-nitrofuran-2-carboxylate |
| SMILES | Cc1cc(C(=O)COC(=O)c2ccc([N+](=O)[O-])o2)c(C)n1-c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C20H15F3N2O6/c1-11-8-15(12(2)24(11)14-5-3-4-13(9-14)20(21,22)23)16(26)10-30-19(27)17-6-7-18(31-17)25(28)29/h3-9H,10H2,1-2H3 |
| InChIKey | WYYIGXPRDMBTFG-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 104.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.34 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|