C20H14F3N3O3 — CID 55513200
(4-cyano-2-methoxyphenyl) 5-methyl-1-[3-(trifluoromethyl)phenyl]pyrazole-4-carboxylate (PubChem CID 55513200) has the molecular formula C20H14F3N3O3 and a molecular weight of 401.34 g/mol. Its IUPAC name is (4-cyano-2-methoxyphenyl) 5-methyl-1-[3-(trifluoromethyl)phenyl]pyrazole-4-carboxylate.
| Compound Name | (4-cyano-2-methoxyphenyl) 5-methyl-1-[3-(trifluoromethyl)phenyl]pyrazole-4-carboxylate |
|---|---|
| PubChem CID | 55513200 |
| Molecular Formula | C20H14F3N3O3 |
| Molecular Weight | 401.34 g/mol |
| Exact Mass | 401.10 |
| IUPAC Name | (4-cyano-2-methoxyphenyl) 5-methyl-1-[3-(trifluoromethyl)phenyl]pyrazole-4-carboxylate |
| SMILES | COc1cc(C#N)ccc1OC(=O)c1cnn(-c2cccc(C(F)(F)F)c2)c1C |
| InChI | InChI=1S/C20H14F3N3O3/c1-12-16(19(27)29-17-7-6-13(10-24)8-18(17)28-2)11-25-26(12)15-5-3-4-14(9-15)20(21,22)23/h3-9,11H,1-2H3 |
| InChIKey | QWRSPKDFALBSPO-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 77.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.34 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|