C18H19N5O — CID 16508138
1-(2,5-dimethyl-1-prop-2-enylpyrrol-3-yl)-2-(5-phenyltetrazol-2-yl)ethanone (PubChem CID 16508138) has the molecular formula C18H19N5O and a molecular weight of 321.38 g/mol. Its IUPAC name is 1-(2,5-dimethyl-1-prop-2-enylpyrrol-3-yl)-2-(5-phenyltetrazol-2-yl)ethanone.
| Compound Name | 1-(2,5-dimethyl-1-prop-2-enylpyrrol-3-yl)-2-(5-phenyltetrazol-2-yl)ethanone |
|---|---|
| PubChem CID | 16508138 |
| Molecular Formula | C18H19N5O |
| Molecular Weight | 321.38 g/mol |
| Exact Mass | 321.16 |
| IUPAC Name | 1-(2,5-dimethyl-1-prop-2-enylpyrrol-3-yl)-2-(5-phenyltetrazol-2-yl)ethanone |
| SMILES | C=CCn1c(C)cc(C(=O)Cn2nnc(-c3ccccc3)n2)c1C |
| InChI | InChI=1S/C18H19N5O/c1-4-10-22-13(2)11-16(14(22)3)17(24)12-23-20-18(19-21-23)15-8-6-5-7-9-15/h4-9,11H,1,10,12H2,2-3H3 |
| InChIKey | GPOMEEFLCXRRBN-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 65.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.38 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|