C20H18N2O5 — CID 7563569
2-[2-[4-[(2R)-butan-2-yl]phenyl]-2-oxoethyl]-4-nitroisoindole-1,3-dione (PubChem CID 7563569) has the molecular formula C20H18N2O5 and a molecular weight of 366.37 g/mol. Its IUPAC name is 2-[2-[4-[(2R)-butan-2-yl]phenyl]-2-oxoethyl]-4-nitroisoindole-1,3-dione.
| Compound Name | 2-[2-[4-[(2R)-butan-2-yl]phenyl]-2-oxoethyl]-4-nitroisoindole-1,3-dione |
|---|---|
| PubChem CID | 7563569 |
| Molecular Formula | C20H18N2O5 |
| Molecular Weight | 366.37 g/mol |
| Exact Mass | 366.12 |
| IUPAC Name | 2-[2-[4-[(2R)-butan-2-yl]phenyl]-2-oxoethyl]-4-nitroisoindole-1,3-dione |
| SMILES | CC[C@@H](C)c1ccc(C(=O)CN2C(=O)c3cccc([N+](=O)[O-])c3C2=O)cc1 |
| InChI | InChI=1S/C20H18N2O5/c1-3-12(2)13-7-9-14(10-8-13)17(23)11-21-19(24)15-5-4-6-16(22(26)27)18(15)20(21)25/h4-10,12H,3,11H2,1-2H3/t12-/m1/s1 |
| InChIKey | BXRJEHABOIMQDQ-GFCCVEGCSA-N |
| XLogP | 3.59 |
| TPSA | 97.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.37 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|