C20H19BrO8 — CID 124891076
(2-bromo-4,5-dimethoxyphenyl)-[(2S,3S)-3-(6,7-dimethoxy-1,3-benzodioxol-5-yl)oxiran-2-yl]methanone (PubChem CID 124891076) has the molecular formula C20H19BrO8 and a molecular weight of 467.27 g/mol. Its IUPAC name is (2-bromo-4,5-dimethoxyphenyl)-[(2S,3S)-3-(6,7-dimethoxy-1,3-benzodioxol-5-yl)oxiran-2-yl]methanone.
| Compound Name | (2-bromo-4,5-dimethoxyphenyl)-[(2S,3S)-3-(6,7-dimethoxy-1,3-benzodioxol-5-yl)oxiran-2-yl]methanone |
|---|---|
| PubChem CID | 124891076 |
| Molecular Formula | C20H19BrO8 |
| Molecular Weight | 467.27 g/mol |
| Exact Mass | 466.03 |
| IUPAC Name | (2-bromo-4,5-dimethoxyphenyl)-[(2S,3S)-3-(6,7-dimethoxy-1,3-benzodioxol-5-yl)oxiran-2-yl]methanone |
| SMILES | COc1cc(Br)c(C(=O)[C@H]2O[C@H]2c2cc3c(c(OC)c2OC)OCO3)cc1OC |
| InChI | InChI=1S/C20H19BrO8/c1-23-12-5-9(11(21)7-13(12)24-2)15(22)19-17(29-19)10-6-14-18(28-8-27-14)20(26-4)16(10)25-3/h5-7,17,19H,8H2,1-4H3/t17-,19+/m0/s1 |
| InChIKey | IBRWOZCRRUHDGY-PKOBYXMFSA-N |
| XLogP | 3.54 |
| TPSA | 84.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.27 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|