C22H17FO3 — CID 26985531
[(2S,3S)-3-(4-fluorophenyl)oxiran-2-yl]-(2-phenylmethoxyphenyl)methanone (PubChem CID 26985531) has the molecular formula C22H17FO3 and a molecular weight of 348.37 g/mol. Its IUPAC name is [(2S,3S)-3-(4-fluorophenyl)oxiran-2-yl]-(2-phenylmethoxyphenyl)methanone.
| Compound Name | [(2S,3S)-3-(4-fluorophenyl)oxiran-2-yl]-(2-phenylmethoxyphenyl)methanone |
|---|---|
| PubChem CID | 26985531 |
| Molecular Formula | C22H17FO3 |
| Molecular Weight | 348.37 g/mol |
| Exact Mass | 348.12 |
| IUPAC Name | [(2S,3S)-3-(4-fluorophenyl)oxiran-2-yl]-(2-phenylmethoxyphenyl)methanone |
| SMILES | O=C(c1ccccc1OCc1ccccc1)[C@H]1O[C@H]1c1ccc(F)cc1 |
| InChI | InChI=1S/C22H17FO3/c23-17-12-10-16(11-13-17)21-22(26-21)20(24)18-8-4-5-9-19(18)25-14-15-6-2-1-3-7-15/h1-13,21-22H,14H2/t21-,22+/m0/s1 |
| InChIKey | GOENYUXCFIBHMA-FCHUYYIVSA-N |
| XLogP | 4.73 |
| TPSA | 38.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.37 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|