C24H22O5 — CID 7036132
[(2S,3R)-3-(2,5-dimethoxyphenyl)oxiran-2-yl]-(2-phenylmethoxyphenyl)methanone (PubChem CID 7036132) has the molecular formula C24H22O5 and a molecular weight of 390.44 g/mol. Its IUPAC name is [(2S,3R)-3-(2,5-dimethoxyphenyl)oxiran-2-yl]-(2-phenylmethoxyphenyl)methanone.
| Compound Name | [(2S,3R)-3-(2,5-dimethoxyphenyl)oxiran-2-yl]-(2-phenylmethoxyphenyl)methanone |
|---|---|
| PubChem CID | 7036132 |
| Molecular Formula | C24H22O5 |
| Molecular Weight | 390.44 g/mol |
| Exact Mass | 390.15 |
| IUPAC Name | [(2S,3R)-3-(2,5-dimethoxyphenyl)oxiran-2-yl]-(2-phenylmethoxyphenyl)methanone |
| SMILES | COc1ccc(OC)c([C@H]2O[C@@H]2C(=O)c2ccccc2OCc2ccccc2)c1 |
| InChI | InChI=1S/C24H22O5/c1-26-17-12-13-20(27-2)19(14-17)23-24(29-23)22(25)18-10-6-7-11-21(18)28-15-16-8-4-3-5-9-16/h3-14,23-24H,15H2,1-2H3/t23-,24-/m1/s1 |
| InChIKey | XJXKMAKJQACSNW-DNQXCXABSA-N |
| XLogP | 4.61 |
| TPSA | 57.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.44 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|