C20H17NO3S — CID 3554885
[3-(2-methyl-1,3-thiazol-4-yl)oxiran-2-yl]-(2-phenylmethoxyphenyl)methanone (PubChem CID 3554885) has the molecular formula C20H17NO3S and a molecular weight of 351.43 g/mol. Its IUPAC name is [3-(2-methyl-1,3-thiazol-4-yl)oxiran-2-yl]-(2-phenylmethoxyphenyl)methanone.
| Compound Name | [3-(2-methyl-1,3-thiazol-4-yl)oxiran-2-yl]-(2-phenylmethoxyphenyl)methanone |
|---|---|
| PubChem CID | 3554885 |
| Molecular Formula | C20H17NO3S |
| Molecular Weight | 351.43 g/mol |
| Exact Mass | 351.09 |
| IUPAC Name | [3-(2-methyl-1,3-thiazol-4-yl)oxiran-2-yl]-(2-phenylmethoxyphenyl)methanone |
| SMILES | Cc1nc(C2OC2C(=O)c2ccccc2OCc2ccccc2)cs1 |
| InChI | InChI=1S/C20H17NO3S/c1-13-21-16(12-25-13)19-20(24-19)18(22)15-9-5-6-10-17(15)23-11-14-7-3-2-4-8-14/h2-10,12,19-20H,11H2,1H3 |
| InChIKey | ZSEKGKSKPDFLHU-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 51.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.43 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|