C23H17O5- — CID 7036125
4-[(2S,3R)-3-(2-phenylmethoxybenzoyl)oxiran-2-yl]benzoate (PubChem CID 7036125) has the molecular formula C23H17O5- and a molecular weight of 373.38 g/mol. Its IUPAC name is 4-[(2S,3R)-3-(2-phenylmethoxybenzoyl)oxiran-2-yl]benzoate.
| Compound Name | 4-[(2S,3R)-3-(2-phenylmethoxybenzoyl)oxiran-2-yl]benzoate |
|---|---|
| PubChem CID | 7036125 |
| Molecular Formula | C23H17O5- |
| Molecular Weight | 373.38 g/mol |
| Exact Mass | 373.11 |
| IUPAC Name | 4-[(2S,3R)-3-(2-phenylmethoxybenzoyl)oxiran-2-yl]benzoate |
| SMILES | O=C([O-])c1ccc([C@@H]2O[C@H]2C(=O)c2ccccc2OCc2ccccc2)cc1 |
| InChI | InChI=1S/C23H18O5/c24-20(22-21(28-22)16-10-12-17(13-11-16)23(25)26)18-8-4-5-9-19(18)27-14-15-6-2-1-3-7-15/h1-13,21-22H,14H2,(H,25,26)/p-1/t21-,22-/m0/s1 |
| InChIKey | GWCOJZCMEYWBAX-VXKWHMMOSA-M |
| XLogP | 2.95 |
| TPSA | 78.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.38 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|