C21H23N3O8 — CID 27192992
[2-(N-(3-amino-3-oxopropyl)anilino)-2-oxoethyl] 4-ethoxy-5-methoxy-2-nitrobenzoate (PubChem CID 27192992) has the molecular formula C21H23N3O8 and a molecular weight of 445.43 g/mol. Its IUPAC name is [2-(N-(3-amino-3-oxopropyl)anilino)-2-oxoethyl] 4-ethoxy-5-methoxy-2-nitrobenzoate.
| Compound Name | [2-(N-(3-amino-3-oxopropyl)anilino)-2-oxoethyl] 4-ethoxy-5-methoxy-2-nitrobenzoate |
|---|---|
| PubChem CID | 27192992 |
| Molecular Formula | C21H23N3O8 |
| Molecular Weight | 445.43 g/mol |
| Exact Mass | 445.15 |
| IUPAC Name | [2-(N-(3-amino-3-oxopropyl)anilino)-2-oxoethyl] 4-ethoxy-5-methoxy-2-nitrobenzoate |
| SMILES | CCOc1cc([N+](=O)[O-])c(C(=O)OCC(=O)N(CCC(N)=O)c2ccccc2)cc1OC |
| InChI | InChI=1S/C21H23N3O8/c1-3-31-18-12-16(24(28)29)15(11-17(18)30-2)21(27)32-13-20(26)23(10-9-19(22)25)14-7-5-4-6-8-14/h4-8,11-12H,3,9-10,13H2,1-2H3,(H2,22,25) |
| InChIKey | YZLYVKWNCKIELH-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 151.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.43 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|