C19H17N3O5S — CID 7257413
[2-(4-methoxyphenyl)-1,3-thiazol-4-yl]methyl 4-(methylamino)-3-nitrobenzoate (PubChem CID 7257413) has the molecular formula C19H17N3O5S and a molecular weight of 399.43 g/mol. Its IUPAC name is [2-(4-methoxyphenyl)-1,3-thiazol-4-yl]methyl 4-(methylamino)-3-nitrobenzoate.
| Compound Name | [2-(4-methoxyphenyl)-1,3-thiazol-4-yl]methyl 4-(methylamino)-3-nitrobenzoate |
|---|---|
| PubChem CID | 7257413 |
| Molecular Formula | C19H17N3O5S |
| Molecular Weight | 399.43 g/mol |
| Exact Mass | 399.09 |
| IUPAC Name | [2-(4-methoxyphenyl)-1,3-thiazol-4-yl]methyl 4-(methylamino)-3-nitrobenzoate |
| SMILES | CNc1ccc(C(=O)OCc2csc(-c3ccc(OC)cc3)n2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C19H17N3O5S/c1-20-16-8-5-13(9-17(16)22(24)25)19(23)27-10-14-11-28-18(21-14)12-3-6-15(26-2)7-4-12/h3-9,11,20H,10H2,1-2H3 |
| InChIKey | ZCKMSUCBZSBGOU-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 103.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.43 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|