C17H16N4O4 — CID 27187833
(8-methylimidazo[1,2-a]pyridin-2-yl)methyl 4-(methylamino)-3-nitrobenzoate (PubChem CID 27187833) has the molecular formula C17H16N4O4 and a molecular weight of 340.34 g/mol. Its IUPAC name is (8-methylimidazo[1,2-a]pyridin-2-yl)methyl 4-(methylamino)-3-nitrobenzoate.
| Compound Name | (8-methylimidazo[1,2-a]pyridin-2-yl)methyl 4-(methylamino)-3-nitrobenzoate |
|---|---|
| PubChem CID | 27187833 |
| Molecular Formula | C17H16N4O4 |
| Molecular Weight | 340.34 g/mol |
| Exact Mass | 340.12 |
| IUPAC Name | (8-methylimidazo[1,2-a]pyridin-2-yl)methyl 4-(methylamino)-3-nitrobenzoate |
| SMILES | CNc1ccc(C(=O)OCc2cn3cccc(C)c3n2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C17H16N4O4/c1-11-4-3-7-20-9-13(19-16(11)20)10-25-17(22)12-5-6-14(18-2)15(8-12)21(23)24/h3-9,18H,10H2,1-2H3 |
| InChIKey | SXLFRHUJIBOAGH-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.34 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|