C33H40N6O6 — CID 73213622
ethyl 3-[[2-[1-[4-[amino-(butoxycarbonylamino)methyl]phenoxy]ethyl]-1-methylbenzimidazole-5-carbonyl]-pyridin-2-ylamino]propanoate (PubChem CID 73213622) has the molecular formula C33H40N6O6 and a molecular weight of 616.72 g/mol. Its IUPAC name is ethyl 3-[[2-[1-[4-[amino-(butoxycarbonylamino)methyl]phenoxy]ethyl]-1-methylbenzimidazole-5-carbonyl]-pyridin-2-ylamino]propanoate.
| Compound Name | ethyl 3-[[2-[1-[4-[amino-(butoxycarbonylamino)methyl]phenoxy]ethyl]-1-methylbenzimidazole-5-carbonyl]-pyridin-2-ylamino]propanoate |
|---|---|
| PubChem CID | 73213622 |
| Molecular Formula | C33H40N6O6 |
| Molecular Weight | 616.72 g/mol |
| Exact Mass | 616.30 |
| IUPAC Name | ethyl 3-[[2-[1-[4-[amino-(butoxycarbonylamino)methyl]phenoxy]ethyl]-1-methylbenzimidazole-5-carbonyl]-pyridin-2-ylamino]propanoate |
| SMILES | CCCCOC(=O)NC(N)c1ccc(OC(C)c2nc3cc(C(=O)N(CCC(=O)OCC)c4ccccn4)ccc3n2C)cc1 |
| InChI | InChI=1S/C33H40N6O6/c1-5-7-20-44-33(42)37-30(34)23-11-14-25(15-12-23)45-22(3)31-36-26-21-24(13-16-27(26)38(31)4)32(41)39(19-17-29(40)43-6-2)28-10-8-9-18-35-28/h8-16,18,21-22,30H,5-7,17,19-20,34H2,1-4H3,(H,37,42) |
| InChIKey | WEKYYUHVVWSZNT-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 150.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.72 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|