C41H49N7O5 — CID 145011616
(2-propan-2-ylphenyl) 3-[[2-[[4-[amino-(hexoxycarbonylamino)methyl]anilino]methyl]-1-methylbenzimidazole-5-carbonyl]-pyridin-2-ylamino]propanoate (PubChem CID 145011616) has the molecular formula C41H49N7O5 and a molecular weight of 719.89 g/mol. Its IUPAC name is (2-propan-2-ylphenyl) 3-[[2-[[4-[amino-(hexoxycarbonylamino)methyl]anilino]methyl]-1-methylbenzimidazole-5-carbonyl]-pyridin-2-ylamino]propanoate.
| Compound Name | (2-propan-2-ylphenyl) 3-[[2-[[4-[amino-(hexoxycarbonylamino)methyl]anilino]methyl]-1-methylbenzimidazole-5-carbonyl]-pyridin-2-ylamino]propanoate |
|---|---|
| PubChem CID | 145011616 |
| Molecular Formula | C41H49N7O5 |
| Molecular Weight | 719.89 g/mol |
| Exact Mass | 719.38 |
| IUPAC Name | (2-propan-2-ylphenyl) 3-[[2-[[4-[amino-(hexoxycarbonylamino)methyl]anilino]methyl]-1-methylbenzimidazole-5-carbonyl]-pyridin-2-ylamino]propanoate |
| SMILES | CCCCCCOC(=O)NC(N)c1ccc(NCc2nc3cc(C(=O)N(CCC(=O)Oc4ccccc4C(C)C)c4ccccn4)ccc3n2C)cc1 |
| InChI | InChI=1S/C41H49N7O5/c1-5-6-7-12-25-52-41(51)46-39(42)29-16-19-31(20-17-29)44-27-37-45-33-26-30(18-21-34(33)47(37)4)40(50)48(36-15-10-11-23-43-36)24-22-38(49)53-35-14-9-8-13-32(35)28(2)3/h8-11,13-21,23,26,28,39,44H,5-7,12,22,24-25,27,42H2,1-4H3,(H,46,51) |
| InChIKey | QCXQZGVZAPQNDF-UHFFFAOYSA-N |
| XLogP | 7.61 |
| TPSA | 153.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 719.89 |
| LogP ≤ 5 | 7.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|