C32H38N6O6 — CID 73214480
methyl 3-[[2-[[4-[amino-(pentoxycarbonylamino)methyl]phenoxy]methyl]-1-methylbenzimidazole-5-carbonyl]-pyridin-2-ylamino]propanoate (PubChem CID 73214480) has the molecular formula C32H38N6O6 and a molecular weight of 602.69 g/mol. Its IUPAC name is methyl 3-[[2-[[4-[amino-(pentoxycarbonylamino)methyl]phenoxy]methyl]-1-methylbenzimidazole-5-carbonyl]-pyridin-2-ylamino]propanoate.
| Compound Name | methyl 3-[[2-[[4-[amino-(pentoxycarbonylamino)methyl]phenoxy]methyl]-1-methylbenzimidazole-5-carbonyl]-pyridin-2-ylamino]propanoate |
|---|---|
| PubChem CID | 73214480 |
| Molecular Formula | C32H38N6O6 |
| Molecular Weight | 602.69 g/mol |
| Exact Mass | 602.29 |
| IUPAC Name | methyl 3-[[2-[[4-[amino-(pentoxycarbonylamino)methyl]phenoxy]methyl]-1-methylbenzimidazole-5-carbonyl]-pyridin-2-ylamino]propanoate |
| SMILES | CCCCCOC(=O)NC(N)c1ccc(OCc2nc3cc(C(=O)N(CCC(=O)OC)c4ccccn4)ccc3n2C)cc1 |
| InChI | InChI=1S/C32H38N6O6/c1-4-5-8-19-43-32(41)36-30(33)22-10-13-24(14-11-22)44-21-28-35-25-20-23(12-15-26(25)37(28)2)31(40)38(18-16-29(39)42-3)27-9-6-7-17-34-27/h6-7,9-15,17,20,30H,4-5,8,16,18-19,21,33H2,1-3H3,(H,36,41) |
| InChIKey | PSXPZFVYTKLNKG-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 150.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.69 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|