C34H41N7O5 — CID 140642212
ethyl 3-[[2-[[4-(N-heptoxycarbonylcarbamimidoyl)anilino]methyl]-3H-benzimidazole-5-carbonyl]-pyridin-2-ylamino]propanoate (PubChem CID 140642212) has the molecular formula C34H41N7O5 and a molecular weight of 627.75 g/mol. Its IUPAC name is ethyl 3-[[2-[[4-(N-heptoxycarbonylcarbamimidoyl)anilino]methyl]-3H-benzimidazole-5-carbonyl]-pyridin-2-ylamino]propanoate.
| Compound Name | ethyl 3-[[2-[[4-(N-heptoxycarbonylcarbamimidoyl)anilino]methyl]-3H-benzimidazole-5-carbonyl]-pyridin-2-ylamino]propanoate |
|---|---|
| PubChem CID | 140642212 |
| Molecular Formula | C34H41N7O5 |
| Molecular Weight | 627.75 g/mol |
| Exact Mass | 627.32 |
| IUPAC Name | ethyl 3-[[2-[[4-(N-heptoxycarbonylcarbamimidoyl)anilino]methyl]-3H-benzimidazole-5-carbonyl]-pyridin-2-ylamino]propanoate |
| SMILES | [H]/N=C(\NC(=O)OCCCCCCC)c1ccc(NCc2nc3ccc(C(=O)N(CCC(=O)OCC)c4ccccn4)cc3[nH]2)cc1 |
| InChI | InChI=1S/C34H41N7O5/c1-3-5-6-7-10-21-46-34(44)40-32(35)24-12-15-26(16-13-24)37-23-29-38-27-17-14-25(22-28(27)39-29)33(43)41(20-18-31(42)45-4-2)30-11-8-9-19-36-30/h8-9,11-17,19,22,37H,3-7,10,18,20-21,23H2,1-2H3,(H,38,39)(H2,35,40,44) |
| InChIKey | FVBKNEGUPBCDGG-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 162.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.75 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|