C39H55N7O6 — CID 173253241
ethyl 4-[[2-[2-[amino-[4-(N-octoxycarbonylcarbamimidoyl)phenyl]methyl]-1-methylbenzimidazol-5-yl]-2-methyl-3-oxo-3-pyrrolidin-1-ylpropyl]amino]-3-oxobutanoate (PubChem CID 173253241) has the molecular formula C39H55N7O6 and a molecular weight of 717.91 g/mol. Its IUPAC name is ethyl 4-[[2-[2-[amino-[4-(N-octoxycarbonylcarbamimidoyl)phenyl]methyl]-1-methylbenzimidazol-5-yl]-2-methyl-3-oxo-3-pyrrolidin-1-ylpropyl]amino]-3-oxobutanoate.
| Compound Name | ethyl 4-[[2-[2-[amino-[4-(N-octoxycarbonylcarbamimidoyl)phenyl]methyl]-1-methylbenzimidazol-5-yl]-2-methyl-3-oxo-3-pyrrolidin-1-ylpropyl]amino]-3-oxobutanoate |
|---|---|
| PubChem CID | 173253241 |
| Molecular Formula | C39H55N7O6 |
| Molecular Weight | 717.91 g/mol |
| Exact Mass | 717.42 |
| IUPAC Name | ethyl 4-[[2-[2-[amino-[4-(N-octoxycarbonylcarbamimidoyl)phenyl]methyl]-1-methylbenzimidazol-5-yl]-2-methyl-3-oxo-3-pyrrolidin-1-ylpropyl]amino]-3-oxobutanoate |
| SMILES | [H]/N=C(\NC(=O)OCCCCCCCC)c1ccc(C(N)c2nc3cc(C(C)(CNCC(=O)CC(=O)OCC)C(=O)N4CCCC4)ccc3n2C)cc1 |
| InChI | InChI=1S/C39H55N7O6/c1-5-7-8-9-10-13-22-52-38(50)44-35(41)28-16-14-27(15-17-28)34(40)36-43-31-23-29(18-19-32(31)45(36)4)39(3,37(49)46-20-11-12-21-46)26-42-25-30(47)24-33(48)51-6-2/h14-19,23,34,42H,5-13,20-22,24-26,40H2,1-4H3,(H2,41,44,50) |
| InChIKey | MMPHRZDLCBCNBL-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 181.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 52 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 717.91 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|