C31H41N7O4 — CID 21194006
ethyl 2-[[2-[2-[(4-carbamimidoylanilino)methyl]-1-methylbenzimidazol-5-yl]-2-methyl-3-oxo-3-piperidin-1-ylpropyl]amino]-3-oxobutanoate (PubChem CID 21194006) has the molecular formula C31H41N7O4 and a molecular weight of 575.71 g/mol. Its IUPAC name is ethyl 2-[[2-[2-[(4-carbamimidoylanilino)methyl]-1-methylbenzimidazol-5-yl]-2-methyl-3-oxo-3-piperidin-1-ylpropyl]amino]-3-oxobutanoate.
| Compound Name | ethyl 2-[[2-[2-[(4-carbamimidoylanilino)methyl]-1-methylbenzimidazol-5-yl]-2-methyl-3-oxo-3-piperidin-1-ylpropyl]amino]-3-oxobutanoate |
|---|---|
| PubChem CID | 21194006 |
| Molecular Formula | C31H41N7O4 |
| Molecular Weight | 575.71 g/mol |
| Exact Mass | 575.32 |
| IUPAC Name | ethyl 2-[[2-[2-[(4-carbamimidoylanilino)methyl]-1-methylbenzimidazol-5-yl]-2-methyl-3-oxo-3-piperidin-1-ylpropyl]amino]-3-oxobutanoate |
| SMILES | [H]/N=C(\N)c1ccc(NCc2nc3cc(C(C)(CNC(C(C)=O)C(=O)OCC)C(=O)N4CCCCC4)ccc3n2C)cc1 |
| InChI | InChI=1S/C31H41N7O4/c1-5-42-29(40)27(20(2)39)35-19-31(3,30(41)38-15-7-6-8-16-38)22-11-14-25-24(17-22)36-26(37(25)4)18-34-23-12-9-21(10-13-23)28(32)33/h9-14,17,27,34-35H,5-8,15-16,18-19H2,1-4H3,(H3,32,33) |
| InChIKey | WLTVHUQGWGLGNR-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 155.43 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.71 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|