C28H37N7O4 — CID 21193783
2-[[2-[2-[(4-carbamimidoylanilino)methyl]-1-methylbenzimidazol-5-yl]-3-[ethyl(methyl)amino]-2-methyl-3-oxopropyl]amino]-3-oxopentanoic acid (PubChem CID 21193783) has the molecular formula C28H37N7O4 and a molecular weight of 535.65 g/mol. Its IUPAC name is 2-[[2-[2-[(4-carbamimidoylanilino)methyl]-1-methylbenzimidazol-5-yl]-3-[ethyl(methyl)amino]-2-methyl-3-oxopropyl]amino]-3-oxopentanoic acid.
| Compound Name | 2-[[2-[2-[(4-carbamimidoylanilino)methyl]-1-methylbenzimidazol-5-yl]-3-[ethyl(methyl)amino]-2-methyl-3-oxopropyl]amino]-3-oxopentanoic acid |
|---|---|
| PubChem CID | 21193783 |
| Molecular Formula | C28H37N7O4 |
| Molecular Weight | 535.65 g/mol |
| Exact Mass | 535.29 |
| IUPAC Name | 2-[[2-[2-[(4-carbamimidoylanilino)methyl]-1-methylbenzimidazol-5-yl]-3-[ethyl(methyl)amino]-2-methyl-3-oxopropyl]amino]-3-oxopentanoic acid |
| SMILES | [H]/N=C(\N)c1ccc(NCc2nc3cc(C(C)(CNC(C(=O)O)C(=O)CC)C(=O)N(C)CC)ccc3n2C)cc1 |
| InChI | InChI=1S/C28H37N7O4/c1-6-22(36)24(26(37)38)32-16-28(3,27(39)34(4)7-2)18-10-13-21-20(14-18)33-23(35(21)5)15-31-19-11-8-17(9-12-19)25(29)30/h8-14,24,31-32H,6-7,15-16H2,1-5H3,(H3,29,30)(H,37,38) |
| InChIKey | IMXCRWDZXWHVRE-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 166.43 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.65 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|