C28H37Cl2N7O4 — CID 21193908
3-[[2-[2-[(4-carbamimidoylanilino)methyl]-1-methylbenzimidazol-5-yl]-2-methyl-3-oxo-3-pyrrolidin-1-ylpropyl]-methylamino]-3-oxopropanoic acid;dihydrochloride (PubChem CID 21193908) has the molecular formula C28H37Cl2N7O4 and a molecular weight of 606.56 g/mol. Its IUPAC name is 3-[[2-[2-[(4-carbamimidoylanilino)methyl]-1-methylbenzimidazol-5-yl]-2-methyl-3-oxo-3-pyrrolidin-1-ylpropyl]-methylamino]-3-oxopropanoic acid;dihydrochloride.
| Compound Name | 3-[[2-[2-[(4-carbamimidoylanilino)methyl]-1-methylbenzimidazol-5-yl]-2-methyl-3-oxo-3-pyrrolidin-1-ylpropyl]-methylamino]-3-oxopropanoic acid;dihydrochloride |
|---|---|
| PubChem CID | 21193908 |
| Molecular Formula | C28H37Cl2N7O4 |
| Molecular Weight | 606.56 g/mol |
| Exact Mass | 605.23 |
| IUPAC Name | 3-[[2-[2-[(4-carbamimidoylanilino)methyl]-1-methylbenzimidazol-5-yl]-2-methyl-3-oxo-3-pyrrolidin-1-ylpropyl]-methylamino]-3-oxopropanoic acid;dihydrochloride |
| SMILES | Cl.Cl.[H]/N=C(\N)c1ccc(NCc2nc3cc(C(C)(CN(C)C(=O)CC(=O)O)C(=O)N4CCCC4)ccc3n2C)cc1 |
| InChI | InChI=1S/C28H35N7O4.2ClH/c1-28(27(39)35-12-4-5-13-35,17-33(2)24(36)15-25(37)38)19-8-11-22-21(14-19)32-23(34(22)3)16-31-20-9-6-18(7-10-20)26(29)30;;/h6-11,14,31H,4-5,12-13,15-17H2,1-3H3,(H3,29,30)(H,37,38);2*1H |
| InChIKey | RGEGCUIDXKPJJA-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 157.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.56 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|