C27H36ClN7O3 — CID 70083549
ethyl 3-[[2-[(4-carbamimidoylanilino)methyl]-1-methylbenzimidazol-5-yl]methylamino]-4-oxo-4-pyrrolidin-1-ylbutanoate;hydrochloride (PubChem CID 70083549) has the molecular formula C27H36ClN7O3 and a molecular weight of 542.08 g/mol. Its IUPAC name is ethyl 3-[[2-[(4-carbamimidoylanilino)methyl]-1-methylbenzimidazol-5-yl]methylamino]-4-oxo-4-pyrrolidin-1-ylbutanoate;hydrochloride.
| Compound Name | ethyl 3-[[2-[(4-carbamimidoylanilino)methyl]-1-methylbenzimidazol-5-yl]methylamino]-4-oxo-4-pyrrolidin-1-ylbutanoate;hydrochloride |
|---|---|
| PubChem CID | 70083549 |
| Molecular Formula | C27H36ClN7O3 |
| Molecular Weight | 542.08 g/mol |
| Exact Mass | 541.26 |
| IUPAC Name | ethyl 3-[[2-[(4-carbamimidoylanilino)methyl]-1-methylbenzimidazol-5-yl]methylamino]-4-oxo-4-pyrrolidin-1-ylbutanoate;hydrochloride |
| SMILES | Cl.[H]/N=C(\N)c1ccc(NCc2nc3cc(CNC(CC(=O)OCC)C(=O)N4CCCC4)ccc3n2C)cc1 |
| InChI | InChI=1S/C27H35N7O3.ClH/c1-3-37-25(35)15-22(27(36)34-12-4-5-13-34)31-16-18-6-11-23-21(14-18)32-24(33(23)2)17-30-20-9-7-19(8-10-20)26(28)29;/h6-11,14,22,30-31H,3-5,12-13,15-17H2,1-2H3,(H3,28,29);1H |
| InChIKey | KFJBBBISLBZWFS-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 138.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.08 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|