C33H47N7O5 — CID 21194013
ethyl 3-[[2-[2-[amino-[4-[(Z)-N'-hexoxycarbonylcarbamimidoyl]phenyl]methyl]-1-methylbenzimidazol-5-yl]-1-(dimethylamino)-1-oxopropan-2-yl]amino]propanoate (PubChem CID 21194013) has the molecular formula C33H47N7O5 and a molecular weight of 621.78 g/mol. Its IUPAC name is ethyl 3-[[2-[2-[amino-[4-[(Z)-N'-hexoxycarbonylcarbamimidoyl]phenyl]methyl]-1-methylbenzimidazol-5-yl]-1-(dimethylamino)-1-oxopropan-2-yl]amino]propanoate.
| Compound Name | ethyl 3-[[2-[2-[amino-[4-[(Z)-N'-hexoxycarbonylcarbamimidoyl]phenyl]methyl]-1-methylbenzimidazol-5-yl]-1-(dimethylamino)-1-oxopropan-2-yl]amino]propanoate |
|---|---|
| PubChem CID | 21194013 |
| Molecular Formula | C33H47N7O5 |
| Molecular Weight | 621.78 g/mol |
| Exact Mass | 621.36 |
| IUPAC Name | ethyl 3-[[2-[2-[amino-[4-[(Z)-N'-hexoxycarbonylcarbamimidoyl]phenyl]methyl]-1-methylbenzimidazol-5-yl]-1-(dimethylamino)-1-oxopropan-2-yl]amino]propanoate |
| SMILES | CCCCCCOC(=O)/N=C(\N)c1ccc(C(N)c2nc3cc(C(C)(NCCC(=O)OCC)C(=O)N(C)C)ccc3n2C)cc1 |
| InChI | InChI=1S/C33H47N7O5/c1-7-9-10-11-20-45-32(43)38-29(35)23-14-12-22(13-15-23)28(34)30-37-25-21-24(16-17-26(25)40(30)6)33(3,31(42)39(4)5)36-19-18-27(41)44-8-2/h12-17,21,28,36H,7-11,18-20,34H2,1-6H3,(H2,35,38,43) |
| InChIKey | ZQJOFEIDDJBZBI-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 167.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.78 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|