C37H50N8O5 — CID 144920669
2-(dimethylamino)ethyl 3-[[(1E)-1-[(Z)-ethylideneamino]buta-1,3-dienyl]-[2-[[4-[(Z)-N'-hexoxycarbonylcarbamimidoyl]anilino]methyl]-1-methylbenzimidazole-5-carbonyl]amino]propanoate (PubChem CID 144920669) has the molecular formula C37H50N8O5 and a molecular weight of 686.86 g/mol. Its IUPAC name is 2-(dimethylamino)ethyl 3-[[(1E)-1-[(Z)-ethylideneamino]buta-1,3-dienyl]-[2-[[4-[(Z)-N'-hexoxycarbonylcarbamimidoyl]anilino]methyl]-1-methylbenzimidazole-5-carbonyl]amino]propanoate.
| Compound Name | 2-(dimethylamino)ethyl 3-[[(1E)-1-[(Z)-ethylideneamino]buta-1,3-dienyl]-[2-[[4-[(Z)-N'-hexoxycarbonylcarbamimidoyl]anilino]methyl]-1-methylbenzimidazole-5-carbonyl]amino]propanoate |
|---|---|
| PubChem CID | 144920669 |
| Molecular Formula | C37H50N8O5 |
| Molecular Weight | 686.86 g/mol |
| Exact Mass | 686.39 |
| IUPAC Name | 2-(dimethylamino)ethyl 3-[[(1E)-1-[(Z)-ethylideneamino]buta-1,3-dienyl]-[2-[[4-[(Z)-N'-hexoxycarbonylcarbamimidoyl]anilino]methyl]-1-methylbenzimidazole-5-carbonyl]amino]propanoate |
| SMILES | C=C/C=C(\N=C/C)N(CCC(=O)OCCN(C)C)C(=O)c1ccc2c(c1)nc(CNc1ccc(/C(N)=N/C(=O)OCCCCCC)cc1)n2C |
| InChI | InChI=1S/C37H50N8O5/c1-7-10-11-12-23-50-37(48)42-35(38)27-14-17-29(18-15-27)40-26-33-41-30-25-28(16-19-31(30)44(33)6)36(47)45(32(13-8-2)39-9-3)21-20-34(46)49-24-22-43(4)5/h8-9,13-19,25,40H,2,7,10-12,20-24,26H2,1,3-6H3,(H2,38,42,48)/b32-13+,39-9- |
| InChIKey | TXFSDEGLKSRVIL-ZVRIYLFISA-N |
| XLogP | 5.66 |
| TPSA | 156.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 686.86 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|