C39H39N5O5 — CID 18674233
benzyl 2-[[2-[2-(4-cyanophenyl)ethyl]-1-methylbenzimidazole-5-carbonyl]amino]-6-(phenylmethoxycarbonylamino)hexanoate (PubChem CID 18674233) has the molecular formula C39H39N5O5 and a molecular weight of 657.77 g/mol. Its IUPAC name is benzyl 2-[[2-[2-(4-cyanophenyl)ethyl]-1-methylbenzimidazole-5-carbonyl]amino]-6-(phenylmethoxycarbonylamino)hexanoate.
| Compound Name | benzyl 2-[[2-[2-(4-cyanophenyl)ethyl]-1-methylbenzimidazole-5-carbonyl]amino]-6-(phenylmethoxycarbonylamino)hexanoate |
|---|---|
| PubChem CID | 18674233 |
| Molecular Formula | C39H39N5O5 |
| Molecular Weight | 657.77 g/mol |
| Exact Mass | 657.30 |
| IUPAC Name | benzyl 2-[[2-[2-(4-cyanophenyl)ethyl]-1-methylbenzimidazole-5-carbonyl]amino]-6-(phenylmethoxycarbonylamino)hexanoate |
| SMILES | Cn1c(CCc2ccc(C#N)cc2)nc2cc(C(=O)NC(CCCCNC(=O)OCc3ccccc3)C(=O)OCc3ccccc3)ccc21 |
| InChI | InChI=1S/C39H39N5O5/c1-44-35-21-20-32(24-34(35)42-36(44)22-19-28-15-17-29(25-40)18-16-28)37(45)43-33(38(46)48-26-30-10-4-2-5-11-30)14-8-9-23-41-39(47)49-27-31-12-6-3-7-13-31/h2-7,10-13,15-18,20-21,24,33H,8-9,14,19,22-23,26-27H2,1H3,(H,41,47)(H,43,45) |
| InChIKey | CACSQVHJWSOGFS-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 135.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.77 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|