C34H40N6O2 — CID 22569883
2-[2-(4-cyanophenyl)ethyl]-1-(3-ethoxypropyl)-N-[4-(2-phenylethyl)piperazin-1-yl]benzimidazole-5-carboxamide (PubChem CID 22569883) has the molecular formula C34H40N6O2 and a molecular weight of 564.73 g/mol. Its IUPAC name is 2-[2-(4-cyanophenyl)ethyl]-1-(3-ethoxypropyl)-N-[4-(2-phenylethyl)piperazin-1-yl]benzimidazole-5-carboxamide.
| Compound Name | 2-[2-(4-cyanophenyl)ethyl]-1-(3-ethoxypropyl)-N-[4-(2-phenylethyl)piperazin-1-yl]benzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 22569883 |
| Molecular Formula | C34H40N6O2 |
| Molecular Weight | 564.73 g/mol |
| Exact Mass | 564.32 |
| IUPAC Name | 2-[2-(4-cyanophenyl)ethyl]-1-(3-ethoxypropyl)-N-[4-(2-phenylethyl)piperazin-1-yl]benzimidazole-5-carboxamide |
| SMILES | CCOCCCn1c(CCc2ccc(C#N)cc2)nc2cc(C(=O)NN3CCN(CCc4ccccc4)CC3)ccc21 |
| InChI | InChI=1S/C34H40N6O2/c1-2-42-24-6-18-40-32-15-14-30(25-31(32)36-33(40)16-13-28-9-11-29(26-35)12-10-28)34(41)37-39-22-20-38(21-23-39)19-17-27-7-4-3-5-8-27/h3-5,7-12,14-15,25H,2,6,13,16-24H2,1H3,(H,37,41) |
| InChIKey | QEXYGDXPLYYISJ-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 86.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.73 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|