C19H20N2O4 — CID 46309221
1-(2-ethoxyethyl)-2-(phenoxymethyl)benzimidazole-5-carboxylic acid (PubChem CID 46309221) has the molecular formula C19H20N2O4 and a molecular weight of 340.38 g/mol. Its IUPAC name is 1-(2-ethoxyethyl)-2-(phenoxymethyl)benzimidazole-5-carboxylic acid.
| Compound Name | 1-(2-ethoxyethyl)-2-(phenoxymethyl)benzimidazole-5-carboxylic acid |
|---|---|
| PubChem CID | 46309221 |
| Molecular Formula | C19H20N2O4 |
| Molecular Weight | 340.38 g/mol |
| Exact Mass | 340.14 |
| IUPAC Name | 1-(2-ethoxyethyl)-2-(phenoxymethyl)benzimidazole-5-carboxylic acid |
| SMILES | CCOCCn1c(COc2ccccc2)nc2cc(C(=O)O)ccc21 |
| InChI | InChI=1S/C19H20N2O4/c1-2-24-11-10-21-17-9-8-14(19(22)23)12-16(17)20-18(21)13-25-15-6-4-3-5-7-15/h3-9,12H,2,10-11,13H2,1H3,(H,22,23) |
| InChIKey | UJMOVRDGRHQAAI-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.38 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|