C29H38N4O3 — CID 67845765
methyl 3-[[1-(4-phenylbutyl)-2-(2-piperidin-4-ylethyl)benzimidazole-5-carbonyl]amino]propanoate (PubChem CID 67845765) has the molecular formula C29H38N4O3 and a molecular weight of 490.65 g/mol. Its IUPAC name is methyl 3-[[1-(4-phenylbutyl)-2-(2-piperidin-4-ylethyl)benzimidazole-5-carbonyl]amino]propanoate.
| Compound Name | methyl 3-[[1-(4-phenylbutyl)-2-(2-piperidin-4-ylethyl)benzimidazole-5-carbonyl]amino]propanoate |
|---|---|
| PubChem CID | 67845765 |
| Molecular Formula | C29H38N4O3 |
| Molecular Weight | 490.65 g/mol |
| Exact Mass | 490.29 |
| IUPAC Name | methyl 3-[[1-(4-phenylbutyl)-2-(2-piperidin-4-ylethyl)benzimidazole-5-carbonyl]amino]propanoate |
| SMILES | COC(=O)CCNC(=O)c1ccc2c(c1)nc(CCC1CCNCC1)n2CCCCc1ccccc1 |
| InChI | InChI=1S/C29H38N4O3/c1-36-28(34)16-19-31-29(35)24-11-12-26-25(21-24)32-27(13-10-23-14-17-30-18-15-23)33(26)20-6-5-9-22-7-3-2-4-8-22/h2-4,7-8,11-12,21,23,30H,5-6,9-10,13-20H2,1H3,(H,31,35) |
| InChIKey | NBZGPHSYIBFFTJ-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 85.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.65 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|