C37H45Cl2N7O5 — CID 22569911
N-[4-(5-benzyl-2,4-dioxo-1,3-oxazolidin-3-yl)piperidin-1-yl]-2-[2-(4-carbamimidoylphenyl)ethyl]-1-(3-ethoxypropyl)benzimidazole-5-carboxamide;dihydrochloride (PubChem CID 22569911) has the molecular formula C37H45Cl2N7O5 and a molecular weight of 738.72 g/mol. Its IUPAC name is N-[4-(5-benzyl-2,4-dioxo-1,3-oxazolidin-3-yl)piperidin-1-yl]-2-[2-(4-carbamimidoylphenyl)ethyl]-1-(3-ethoxypropyl)benzimidazole-5-carboxamide;dihydrochloride.
| Compound Name | N-[4-(5-benzyl-2,4-dioxo-1,3-oxazolidin-3-yl)piperidin-1-yl]-2-[2-(4-carbamimidoylphenyl)ethyl]-1-(3-ethoxypropyl)benzimidazole-5-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 22569911 |
| Molecular Formula | C37H45Cl2N7O5 |
| Molecular Weight | 738.72 g/mol |
| Exact Mass | 737.29 |
| IUPAC Name | N-[4-(5-benzyl-2,4-dioxo-1,3-oxazolidin-3-yl)piperidin-1-yl]-2-[2-(4-carbamimidoylphenyl)ethyl]-1-(3-ethoxypropyl)benzimidazole-5-carboxamide;dihydrochloride |
| SMILES | Cl.Cl.[H]/N=C(\N)c1ccc(CCc2nc3cc(C(=O)NN4CCC(N5C(=O)OC(Cc6ccccc6)C5=O)CC4)ccc3n2CCCOCC)cc1 |
| InChI | InChI=1S/C37H43N7O5.2ClH/c1-2-48-22-6-19-43-31-15-14-28(24-30(31)40-33(43)16-11-25-9-12-27(13-10-25)34(38)39)35(45)41-42-20-17-29(18-21-42)44-36(46)32(49-37(44)47)23-26-7-4-3-5-8-26;;/h3-5,7-10,12-15,24,29,32H,2,6,11,16-23H2,1H3,(H3,38,39)(H,41,45);2*1H |
| InChIKey | UNXUUFOMTFGELO-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 155.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 738.72 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|