C37H43N7O5 — CID 90727175
N-[4-(5-benzyl-4-hydroxy-2-oxo-1,3-oxazol-3-yl)piperidin-1-yl]-2-[2-(4-carbamimidoylphenyl)ethyl]-1-(3-ethoxypropyl)benzimidazole-5-carboxamide (PubChem CID 90727175) has the molecular formula C37H43N7O5 and a molecular weight of 665.80 g/mol. Its IUPAC name is N-[4-(5-benzyl-4-hydroxy-2-oxo-1,3-oxazol-3-yl)piperidin-1-yl]-2-[2-(4-carbamimidoylphenyl)ethyl]-1-(3-ethoxypropyl)benzimidazole-5-carboxamide.
| Compound Name | N-[4-(5-benzyl-4-hydroxy-2-oxo-1,3-oxazol-3-yl)piperidin-1-yl]-2-[2-(4-carbamimidoylphenyl)ethyl]-1-(3-ethoxypropyl)benzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 90727175 |
| Molecular Formula | C37H43N7O5 |
| Molecular Weight | 665.80 g/mol |
| Exact Mass | 665.33 |
| IUPAC Name | N-[4-(5-benzyl-4-hydroxy-2-oxo-1,3-oxazol-3-yl)piperidin-1-yl]-2-[2-(4-carbamimidoylphenyl)ethyl]-1-(3-ethoxypropyl)benzimidazole-5-carboxamide |
| SMILES | [H]/N=C(\N)c1ccc(CCc2nc3cc(C(=O)NN4CCC(n5c(O)c(Cc6ccccc6)oc5=O)CC4)ccc3n2CCCOCC)cc1 |
| InChI | InChI=1S/C37H43N7O5/c1-2-48-22-6-19-43-31-15-14-28(24-30(31)40-33(43)16-11-25-9-12-27(13-10-25)34(38)39)35(45)41-42-20-17-29(18-21-42)44-36(46)32(49-37(44)47)23-26-7-4-3-5-8-26/h3-5,7-10,12-15,24,29,46H,2,6,11,16-23H2,1H3,(H3,38,39)(H,41,45) |
| InChIKey | XXAFXUXRFWHVNW-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 164.63 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 49 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 665.80 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|