C30H32Cl2N8O2 — CID 22569920
2-[2-(4-carbamimidoylphenyl)ethyl]-N-[4-[(2,3-dichlorophenyl)carbamoylamino]piperidin-1-yl]-1-methylbenzimidazole-5-carboxamide (PubChem CID 22569920) has the molecular formula C30H32Cl2N8O2 and a molecular weight of 607.55 g/mol. Its IUPAC name is 2-[2-(4-carbamimidoylphenyl)ethyl]-N-[4-[(2,3-dichlorophenyl)carbamoylamino]piperidin-1-yl]-1-methylbenzimidazole-5-carboxamide.
| Compound Name | 2-[2-(4-carbamimidoylphenyl)ethyl]-N-[4-[(2,3-dichlorophenyl)carbamoylamino]piperidin-1-yl]-1-methylbenzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 22569920 |
| Molecular Formula | C30H32Cl2N8O2 |
| Molecular Weight | 607.55 g/mol |
| Exact Mass | 606.20 |
| IUPAC Name | 2-[2-(4-carbamimidoylphenyl)ethyl]-N-[4-[(2,3-dichlorophenyl)carbamoylamino]piperidin-1-yl]-1-methylbenzimidazole-5-carboxamide |
| SMILES | [H]/N=C(\N)c1ccc(CCc2nc3cc(C(=O)NN4CCC(NC(=O)Nc5cccc(Cl)c5Cl)CC4)ccc3n2C)cc1 |
| InChI | InChI=1S/C30H32Cl2N8O2/c1-39-25-11-10-20(17-24(25)36-26(39)12-7-18-5-8-19(9-6-18)28(33)34)29(41)38-40-15-13-21(14-16-40)35-30(42)37-23-4-2-3-22(31)27(23)32/h2-6,8-11,17,21H,7,12-16H2,1H3,(H3,33,34)(H,38,41)(H2,35,37,42) |
| InChIKey | DRHYVAUNAOGCLV-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 141.16 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.55 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|