C32H35N7O4 — CID 10167140
methyl 3-[[1-[2-[2-(4-carbamimidoylphenyl)ethyl]-1-methylbenzimidazole-5-carbonyl]piperidin-4-yl]carbamoylamino]benzoate (PubChem CID 10167140) has the molecular formula C32H35N7O4 and a molecular weight of 581.68 g/mol. Its IUPAC name is methyl 3-[[1-[2-[2-(4-carbamimidoylphenyl)ethyl]-1-methylbenzimidazole-5-carbonyl]piperidin-4-yl]carbamoylamino]benzoate.
| Compound Name | methyl 3-[[1-[2-[2-(4-carbamimidoylphenyl)ethyl]-1-methylbenzimidazole-5-carbonyl]piperidin-4-yl]carbamoylamino]benzoate |
|---|---|
| PubChem CID | 10167140 |
| Molecular Formula | C32H35N7O4 |
| Molecular Weight | 581.68 g/mol |
| Exact Mass | 581.28 |
| IUPAC Name | methyl 3-[[1-[2-[2-(4-carbamimidoylphenyl)ethyl]-1-methylbenzimidazole-5-carbonyl]piperidin-4-yl]carbamoylamino]benzoate |
| SMILES | [H]/N=C(\N)c1ccc(CCc2nc3cc(C(=O)N4CCC(NC(=O)Nc5cccc(C(=O)OC)c5)CC4)ccc3n2C)cc1 |
| InChI | InChI=1S/C32H35N7O4/c1-38-27-12-11-22(19-26(27)37-28(38)13-8-20-6-9-21(10-7-20)29(33)34)30(40)39-16-14-24(15-17-39)35-32(42)36-25-5-3-4-23(18-25)31(41)43-2/h3-7,9-12,18-19,24H,8,13-17H2,1-2H3,(H3,33,34)(H2,35,36,42) |
| InChIKey | TUXJSQXLIXYJRX-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 155.43 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.68 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|