C31H35N7O2S — CID 10166799
1-[1-[2-[2-(4-carbamimidoylphenyl)ethyl]-1-methylbenzimidazole-5-carbonyl]piperidin-4-yl]-3-(3-methylsulfanylphenyl)urea (PubChem CID 10166799) has the molecular formula C31H35N7O2S and a molecular weight of 569.74 g/mol. Its IUPAC name is 1-[1-[2-[2-(4-carbamimidoylphenyl)ethyl]-1-methylbenzimidazole-5-carbonyl]piperidin-4-yl]-3-(3-methylsulfanylphenyl)urea.
| Compound Name | 1-[1-[2-[2-(4-carbamimidoylphenyl)ethyl]-1-methylbenzimidazole-5-carbonyl]piperidin-4-yl]-3-(3-methylsulfanylphenyl)urea |
|---|---|
| PubChem CID | 10166799 |
| Molecular Formula | C31H35N7O2S |
| Molecular Weight | 569.74 g/mol |
| Exact Mass | 569.26 |
| IUPAC Name | 1-[1-[2-[2-(4-carbamimidoylphenyl)ethyl]-1-methylbenzimidazole-5-carbonyl]piperidin-4-yl]-3-(3-methylsulfanylphenyl)urea |
| SMILES | [H]/N=C(\N)c1ccc(CCc2nc3cc(C(=O)N4CCC(NC(=O)Nc5cccc(SC)c5)CC4)ccc3n2C)cc1 |
| InChI | InChI=1S/C31H35N7O2S/c1-37-27-12-11-22(18-26(27)36-28(37)13-8-20-6-9-21(10-7-20)29(32)33)30(39)38-16-14-23(15-17-38)34-31(40)35-24-4-3-5-25(19-24)41-2/h3-7,9-12,18-19,23H,8,13-17H2,1-2H3,(H3,32,33)(H2,34,35,40) |
| InChIKey | XYLUMBFQTAWSGY-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 129.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.74 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|