C29H29F3N8O3 — CID 22569860
2-[2-(4-carbamimidoylphenyl)ethyl]-1-methyl-N-[4-[2-nitro-4-(trifluoromethyl)phenyl]piperazin-1-yl]benzimidazole-5-carboxamide (PubChem CID 22569860) has the molecular formula C29H29F3N8O3 and a molecular weight of 594.60 g/mol. Its IUPAC name is 2-[2-(4-carbamimidoylphenyl)ethyl]-1-methyl-N-[4-[2-nitro-4-(trifluoromethyl)phenyl]piperazin-1-yl]benzimidazole-5-carboxamide.
| Compound Name | 2-[2-(4-carbamimidoylphenyl)ethyl]-1-methyl-N-[4-[2-nitro-4-(trifluoromethyl)phenyl]piperazin-1-yl]benzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 22569860 |
| Molecular Formula | C29H29F3N8O3 |
| Molecular Weight | 594.60 g/mol |
| Exact Mass | 594.23 |
| IUPAC Name | 2-[2-(4-carbamimidoylphenyl)ethyl]-1-methyl-N-[4-[2-nitro-4-(trifluoromethyl)phenyl]piperazin-1-yl]benzimidazole-5-carboxamide |
| SMILES | [H]/N=C(\N)c1ccc(CCc2nc3cc(C(=O)NN4CCN(c5ccc(C(F)(F)F)cc5[N+](=O)[O-])CC4)ccc3n2C)cc1 |
| InChI | InChI=1S/C29H29F3N8O3/c1-37-23-9-7-20(16-22(23)35-26(37)11-4-18-2-5-19(6-3-18)27(33)34)28(41)36-39-14-12-38(13-15-39)24-10-8-21(29(30,31)32)17-25(24)40(42)43/h2-3,5-10,16-17H,4,11-15H2,1H3,(H3,33,34)(H,36,41) |
| InChIKey | YEZOJOHHLNOPCT-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 146.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.60 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|