C31H38N8O — CID 91311152
N-(2-aminoethyl)-2-[2-(4-carbamimidoylphenyl)ethyl]-1-[2-(1-methylpyrrolidin-2-yl)ethyl]-N-pyridin-3-ylbenzimidazole-5-carboxamide (PubChem CID 91311152) has the molecular formula C31H38N8O and a molecular weight of 538.70 g/mol. Its IUPAC name is N-(2-aminoethyl)-2-[2-(4-carbamimidoylphenyl)ethyl]-1-[2-(1-methylpyrrolidin-2-yl)ethyl]-N-pyridin-3-ylbenzimidazole-5-carboxamide.
| Compound Name | N-(2-aminoethyl)-2-[2-(4-carbamimidoylphenyl)ethyl]-1-[2-(1-methylpyrrolidin-2-yl)ethyl]-N-pyridin-3-ylbenzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 91311152 |
| Molecular Formula | C31H38N8O |
| Molecular Weight | 538.70 g/mol |
| Exact Mass | 538.32 |
| IUPAC Name | N-(2-aminoethyl)-2-[2-(4-carbamimidoylphenyl)ethyl]-1-[2-(1-methylpyrrolidin-2-yl)ethyl]-N-pyridin-3-ylbenzimidazole-5-carboxamide |
| SMILES | [H]/N=C(\N)c1ccc(CCc2nc3cc(C(=O)N(CCN)c4cccnc4)ccc3n2CCC2CCCN2C)cc1 |
| InChI | InChI=1S/C31H38N8O/c1-37-17-3-5-25(37)14-18-39-28-12-11-24(31(40)38(19-15-32)26-4-2-16-35-21-26)20-27(28)36-29(39)13-8-22-6-9-23(10-7-22)30(33)34/h2,4,6-7,9-12,16,20-21,25H,3,5,8,13-15,17-19,32H2,1H3,(H3,33,34) |
| InChIKey | YSTKJKDBVFRSER-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 130.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.70 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|