C31H37N5O4 — CID 21250281
ethyl 4-[[1-[3-[(4-carbamimidoylphenyl)methyl]-1-methyl-2-oxoquinoxalin-6-yl]cyclopropyl]-cyclopentylamino]-4-oxobutanoate (PubChem CID 21250281) has the molecular formula C31H37N5O4 and a molecular weight of 543.67 g/mol. Its IUPAC name is ethyl 4-[[1-[3-[(4-carbamimidoylphenyl)methyl]-1-methyl-2-oxoquinoxalin-6-yl]cyclopropyl]-cyclopentylamino]-4-oxobutanoate.
| Compound Name | ethyl 4-[[1-[3-[(4-carbamimidoylphenyl)methyl]-1-methyl-2-oxoquinoxalin-6-yl]cyclopropyl]-cyclopentylamino]-4-oxobutanoate |
|---|---|
| PubChem CID | 21250281 |
| Molecular Formula | C31H37N5O4 |
| Molecular Weight | 543.67 g/mol |
| Exact Mass | 543.28 |
| IUPAC Name | ethyl 4-[[1-[3-[(4-carbamimidoylphenyl)methyl]-1-methyl-2-oxoquinoxalin-6-yl]cyclopropyl]-cyclopentylamino]-4-oxobutanoate |
| SMILES | [H]/N=C(\N)c1ccc(Cc2nc3cc(C4(N(C(=O)CCC(=O)OCC)C5CCCC5)CC4)ccc3n(C)c2=O)cc1 |
| InChI | InChI=1S/C31H37N5O4/c1-3-40-28(38)15-14-27(37)36(23-6-4-5-7-23)31(16-17-31)22-12-13-26-24(19-22)34-25(30(39)35(26)2)18-20-8-10-21(11-9-20)29(32)33/h8-13,19,23H,3-7,14-18H2,1-2H3,(H3,32,33) |
| InChIKey | YBLHADNVJQAWHX-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 131.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.67 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|