About carbon dioxide;N-methyl-N-[4-(trifluoromethyl)phenyl]benzenesulfonamide
carbon dioxide;N-methyl-N-[4-(trifluoromethyl)phenyl]benzenesulfonamide (PubChem CID 159596379) has the molecular formula C15H12F3NO4S
and a molecular weight of 359.33 g/mol. Its IUPAC name is carbon dioxide;N-methyl-N-[4-(trifluoromethyl)phenyl]benzenesulfonamide.
Molecular Properties
| Compound Name | carbon dioxide;N-methyl-N-[4-(trifluoromethyl)phenyl]benzenesulfonamide |
| PubChem CID | 159596379 |
| Molecular Formula | C15H12F3NO4S |
| Molecular Weight | 359.33 g/mol |
| Exact Mass | 359.04 |
| IUPAC Name | carbon dioxide;N-methyl-N-[4-(trifluoromethyl)phenyl]benzenesulfonamide |
| SMILES | CN(c1ccc(C(F)(F)F)cc1)S(=O)(=O)c1ccccc1.O=C=O |
| InChI | InChI=1S/C14H12F3NO2S.CO2/c1-18(21(19,20)13-5-3-2-4-6-13)12-9-7-11(8-10-12)14(15,16)17;2-1-3/h2-10H,1H3; |
| InChIKey | MKWZXHFAFFHEDJ-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 359.33 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze carbon dioxide;N-methyl-N-[4-(trifluoromethyl)phenyl]benzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbon dioxide;N-methyl-N-[4-(trifluoromethyl)phenyl]benzenesulfonamide?
The IUPAC name of carbon dioxide;N-methyl-N-[4-(trifluoromethyl)phenyl]benzenesulfonamide (CID 159596379) is carbon dioxide;N-methyl-N-[4-(trifluoromethyl)phenyl]benzenesulfonamide.
What is the SMILES notation for carbon dioxide;N-methyl-N-[4-(trifluoromethyl)phenyl]benzenesulfonamide?
The canonical SMILES for carbon dioxide;N-methyl-N-[4-(trifluoromethyl)phenyl]benzenesulfonamide is CN(c1ccc(C(F)(F)F)cc1)S(=O)(=O)c1ccccc1.O=C=O.
What is the InChIKey of carbon dioxide;N-methyl-N-[4-(trifluoromethyl)phenyl]benzenesulfonamide?
The InChIKey is MKWZXHFAFFHEDJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12F3NO2S.CO2/c1-18(21(19,20)13-5-3-2-4-6-13)12-9-7-11(8-10-12)14(15,16)17;2-1-3/h2-10H,1H3;.
What are the key properties of carbon dioxide;N-methyl-N-[4-(trifluoromethyl)phenyl]benzenesulfonamide?
carbon dioxide;N-methyl-N-[4-(trifluoromethyl)phenyl]benzenesulfonamide has a molecular weight of 359.33 g/mol, XLogP of 2.95, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for carbon dioxide;N-methyl-N-[4-(trifluoromethyl)phenyl]benzenesulfonamide is sourced from PubChem (CID 159596379), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).